CAS 1213157-92-6 is the registry number for (R)-1-(4-(Pyrrolidin-1-yl)phenyl)ethan-1-amine 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(1R)-1-(4-pyrrolidin-1-ylphenyl)ethanamine (CAS 1213157-92-6) is a chemical compound with the molecular formula C12H18N2 and a molecular weight of 190.28 g/mol. IUPAC name: (1R)-1-(4-pyrrolidin-1-ylphenyl)ethanamine. InChIKey: OCZYPQZGADEYRH-SNVBAGLBSA-N.
| Molecular formula | C12H18N2 |
|---|---|
| Molecular weight | 190.28 g/mol |
| IUPAC name | (1R)-1-(4-pyrrolidin-1-ylphenyl)ethanamine |
| InChIKey | OCZYPQZGADEYRH-SNVBAGLBSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)N2CCCC2)N |
Computed by PubChem (NCBI)