Products 1213180-49-4
CAS 1213180-49-4 is the registry number for (S)-1-(2,4-Dimethylphenyl)-2,2,2-trifluoroethan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-1-(2,4-dimethylphenyl)-2,2,2-trifluoroethanamine (CAS 1213180-49-4) is a chemical compound with the molecular formula C10H12F3N and a molecular weight of 203.20 g/mol. IUPAC name: (1S)-1-(2,4-dimethylphenyl)-2,2,2-trifluoroethanamine. InChIKey: SEYZVMRTNXIDGW-VIFPVBQESA-N.
| Molecular formula | C10H12F3N |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | (1S)-1-(2,4-dimethylphenyl)-2,2,2-trifluoroethanamine |
| InChIKey | SEYZVMRTNXIDGW-VIFPVBQESA-N |
| SMILES | CC1=CC(=C(C=C1)[C@@H](C(F)(F)F)N)C |
Computed by PubChem (NCBI)