Products 1213220-84-8
CAS 1213220-84-8 appears in our catalog under these names: (2R)-2-Amino-2-(2-bromophenyl)ethan-1-ol, 95%, (R)–2–Amino–2–(2–bromophenyl)ethanol. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
(2R)-2-amino-2-(2-bromophenyl)ethanol (CAS 1213220-84-8) is a chemical compound with the molecular formula C8H10BrNO and a molecular weight of 216.07 g/mol. IUPAC name: (2R)-2-amino-2-(2-bromophenyl)ethanol. InChIKey: VUSFGKBTMASDCO-QMMMGPOBSA-N.
| Molecular formula | C8H10BrNO |
|---|---|
| Molecular weight | 216.07 g/mol |
| IUPAC name | (2R)-2-amino-2-(2-bromophenyl)ethanol |
| InChIKey | VUSFGKBTMASDCO-QMMMGPOBSA-N |
| SMILES | C1=CC=C(C(=C1)[C@H](CO)N)Br |
Computed by PubChem (NCBI)
Synonyms:
(R)-2-Amino-2-(2-bromophenyl)ethanol