CAS 1213269-98-7 appears in our catalog under these names: EPI-743, 98+%, Vatiquinone (EPI–743), Vatiquinone, Vatiquinone, 98.38%, 98.38%, EPI-743, 98.60%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 25 mg.
2-[(3R,6E,10E)-3-hydroxy-3,7,11,15-tetramethylhexadeca-6,10,14-trienyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione (CAS 1213269-98-7) is a chemical compound with the molecular formula C29H44O3 and a molecular weight of 440.7 g/mol. IUPAC name: 2-[(3R,6E,10E)-3-hydroxy-3,7,11,15-tetramethylhexadeca-6,10,14-trienyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione. InChIKey: LNOVHERIIMJMDG-XZXLULOTSA-N.
| Molecular formula | C29H44O3 |
|---|---|
| Molecular weight | 440.7 g/mol |
| IUPAC name | 2-[(3R,6E,10E)-3-hydroxy-3,7,11,15-tetramethylhexadeca-6,10,14-trienyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
| InChIKey | LNOVHERIIMJMDG-XZXLULOTSA-N |
| SMILES | CC1=C(C(=O)C(=C(C1=O)C)CC[C@@](C)(CC/C=C(\C)/CC/C=C(\C)/CCC=C(C)C)O)C |
Computed by PubChem (NCBI)