CAS 1213341-91-3 is the registry number for (R)-6-Isopropyl-2,3-dihydro-1H-inden-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-6-propan-2-yl-2,3-dihydro-1H-inden-1-amine (CAS 1213341-91-3) is a chemical compound with the molecular formula C12H17N and a molecular weight of 175.27 g/mol. IUPAC name: (1R)-6-propan-2-yl-2,3-dihydro-1H-inden-1-amine. InChIKey: RMJKUZYESJIKTQ-GFCCVEGCSA-N.
| Molecular formula | C12H17N |
|---|---|
| Molecular weight | 175.27 g/mol |
| IUPAC name | (1R)-6-propan-2-yl-2,3-dihydro-1H-inden-1-amine |
| InChIKey | RMJKUZYESJIKTQ-GFCCVEGCSA-N |
| SMILES | CC(C)C1=CC2=C(CC[C@H]2N)C=C1 |
Computed by PubChem (NCBI)