CAS 1213373-02-4 appears in our catalog under these names: (S)-3-(Pyridin-2-yl)morpholine 95+%, (S)-3-(Pyridin-2-yl)morpholine, 95+%, 95+%. Offered by: Ambeed, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
(3S)-3-pyridin-2-ylmorpholine (CAS 1213373-02-4) is a chemical compound with the molecular formula C9H12N2O and a molecular weight of 164.20 g/mol. IUPAC name: (3S)-3-pyridin-2-ylmorpholine. InChIKey: DVUOZCFMRLDACP-SECBINFHSA-N.
| Molecular formula | C9H12N2O |
|---|---|
| Molecular weight | 164.20 g/mol |
| IUPAC name | (3S)-3-pyridin-2-ylmorpholine |
| InChIKey | DVUOZCFMRLDACP-SECBINFHSA-N |
| SMILES | C1COC[C@@H](N1)C2=CC=CC=N2 |
Computed by PubChem (NCBI)