CAS 1213377-92-4 is the registry number for (R)-1-(2,4-Difluorophenyl)-2-methylpropan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(2,4-difluorophenyl)-2-methylpropan-1-amine (CAS 1213377-92-4) is a chemical compound with the molecular formula C10H13F2N and a molecular weight of 185.21 g/mol. IUPAC name: (1R)-1-(2,4-difluorophenyl)-2-methylpropan-1-amine. InChIKey: LGCSZOFAQLXAQA-SNVBAGLBSA-N.
| Molecular formula | C10H13F2N |
|---|---|
| Molecular weight | 185.21 g/mol |
| IUPAC name | (1R)-1-(2,4-difluorophenyl)-2-methylpropan-1-amine |
| InChIKey | LGCSZOFAQLXAQA-SNVBAGLBSA-N |
| SMILES | CC(C)[C@H](C1=C(C=C(C=C1)F)F)N |
Computed by PubChem (NCBI)