Products 1213472-14-0
CAS 1213472-14-0 is the registry number for (1S)-1-(2-chloropyridin-3-yl)ethan-1-amine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(1S)-1-(2-chloro-3-pyridinyl)ethanamine (CAS 1213472-14-0) is a chemical compound with the molecular formula C7H9ClN2 and a molecular weight of 156.61 g/mol. IUPAC name: (1S)-1-(2-chloro-3-pyridinyl)ethanamine. InChIKey: KRRJPKWZJVRTPE-YFKPBYRVSA-N.
| Molecular formula | C7H9ClN2 |
|---|---|
| Molecular weight | 156.61 g/mol |
| IUPAC name | (1S)-1-(2-chloro-3-pyridinyl)ethanamine |
| InChIKey | KRRJPKWZJVRTPE-YFKPBYRVSA-N |
| SMILES | C[C@@H](C1=C(N=CC=C1)Cl)N |
Computed by PubChem (NCBI)