CAS 121348-98-9 is the registry number for 3,4-Dichloro-N-(2-(dimethylamino)cyclohexyl)-N-methylbenzamide. Offered by: Biosynth. Available pack sizes: 1mg, 5mg, 10mg.
3,4-dichloro-N-[2-(dimethylamino)cyclohexyl]-N-methylbenzamide (CAS 121348-98-9) is a chemical compound with the molecular formula C16H22Cl2N2O and a molecular weight of 329.3 g/mol. IUPAC name: 3,4-dichloro-N-[2-(dimethylamino)cyclohexyl]-N-methylbenzamide. InChIKey: JGPNMZWFVRQNGU-UHFFFAOYSA-N.
| Molecular formula | C16H22Cl2N2O |
|---|---|
| Molecular weight | 329.3 g/mol |
| IUPAC name | 3,4-dichloro-N-[2-(dimethylamino)cyclohexyl]-N-methylbenzamide |
| InChIKey | JGPNMZWFVRQNGU-UHFFFAOYSA-N |
| SMILES | CN(C)C1CCCCC1N(C)C(=O)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)