CAS 1213505-68-0 is the registry number for (R)-1-(3,4-Dimethoxyphenyl)-2,2,2-trifluoroethan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3,4-dimethoxyphenyl)-2,2,2-trifluoroethanamine (CAS 1213505-68-0) is a chemical compound with the molecular formula C10H12F3NO2 and a molecular weight of 235.20 g/mol. IUPAC name: 1-(3,4-dimethoxyphenyl)-2,2,2-trifluoroethanamine. InChIKey: JJNFDHBWILGMKH-UHFFFAOYSA-N.
| Molecular formula | C10H12F3NO2 |
|---|---|
| Molecular weight | 235.20 g/mol |
| IUPAC name | 1-(3,4-dimethoxyphenyl)-2,2,2-trifluoroethanamine |
| InChIKey | JJNFDHBWILGMKH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(C(F)(F)F)N)OC |
Computed by PubChem (NCBI)