Products 2620428-13-7
CAS 2620428-13-7 is the registry number for 2-(2,2,2-Trifluoroacetyl)-2-azaspiro[3.5]nonan-5-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,2,2-trifluoroacetyl)-2-azaspiro[3.5]nonan-5-one (CAS 2620428-13-7) is a chemical compound with the molecular formula C10H12F3NO2 and a molecular weight of 235.20 g/mol. IUPAC name: 2-(2,2,2-trifluoroacetyl)-2-azaspiro[3.5]nonan-5-one. InChIKey: GEUIFMSEZXXYBJ-UHFFFAOYSA-N.
| Molecular formula | C10H12F3NO2 |
|---|---|
| Molecular weight | 235.20 g/mol |
| IUPAC name | 2-(2,2,2-trifluoroacetyl)-2-azaspiro[3.5]nonan-5-one |
| InChIKey | GEUIFMSEZXXYBJ-UHFFFAOYSA-N |
| SMILES | C1CCC2(CN(C2)C(=O)C(F)(F)F)C(=O)C1 |
Computed by PubChem (NCBI)