CAS 1213521-08-4 is the registry number for (R)-6-(Benzyloxy)-1,2,3,4-tetrahydronaphthalen-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-amine (CAS 1213521-08-4) is a chemical compound with the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. IUPAC name: (1R)-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-amine. InChIKey: FASGNUBUMGBAQT-QGZVFWFLSA-N.
| Molecular formula | C17H19NO |
|---|---|
| Molecular weight | 253.34 g/mol |
| IUPAC name | (1R)-6-phenylmethoxy-1,2,3,4-tetrahydronaphthalen-1-amine |
| InChIKey | FASGNUBUMGBAQT-QGZVFWFLSA-N |
| SMILES | C1C[C@H](C2=C(C1)C=C(C=C2)OCC3=CC=CC=C3)N |
Computed by PubChem (NCBI)