CAS 1213546-22-5 appears in our catalog under these names: (2R)-2-(2,6-Dimethylphenyl)pyrrolidine, 95%, (R)–2–(2,6–Dimethylphenyl)pyrrolidine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
(2R)-2-(2,6-dimethylphenyl)pyrrolidine (CAS 1213546-22-5) is a chemical compound with the molecular formula C12H17N and a molecular weight of 175.27 g/mol. IUPAC name: (2R)-2-(2,6-dimethylphenyl)pyrrolidine. InChIKey: XDBWPROXDXLPDU-LLVKDONJSA-N.
| Molecular formula | C12H17N |
|---|---|
| Molecular weight | 175.27 g/mol |
| IUPAC name | (2R)-2-(2,6-dimethylphenyl)pyrrolidine |
| InChIKey | XDBWPROXDXLPDU-LLVKDONJSA-N |
| SMILES | CC1=C(C(=CC=C1)C)[C@H]2CCCN2 |
Computed by PubChem (NCBI)