Products 1213574-69-6
CAS 1213574-69-6 is the registry number for (S)-2-AMINO-2-(3-CHLORO-5-FLUOROPHENYL)ETHAN-1-OL, 95%. Offered by: Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(2S)-2-amino-2-(3-chloro-5-fluorophenyl)ethanol (CAS 1213574-69-6) is a chemical compound with the molecular formula C8H9ClFNO and a molecular weight of 189.61 g/mol. IUPAC name: (2S)-2-amino-2-(3-chloro-5-fluorophenyl)ethanol. InChIKey: PSEARNCXRNCEIO-MRVPVSSYSA-N.
| Molecular formula | C8H9ClFNO |
|---|---|
| Molecular weight | 189.61 g/mol |
| IUPAC name | (2S)-2-amino-2-(3-chloro-5-fluorophenyl)ethanol |
| InChIKey | PSEARNCXRNCEIO-MRVPVSSYSA-N |
| SMILES | C1=C(C=C(C=C1F)Cl)[C@@H](CO)N |
Computed by PubChem (NCBI)