Products 1213588-61-4
CAS 1213588-61-4 is the registry number for (S)-2-Amino-2-(5-bromothiophen-2-yl)ethan-1-ol 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
(2S)-2-amino-2-(5-bromothiophen-2-yl)ethanol (CAS 1213588-61-4) is a chemical compound with the molecular formula C6H8BrNOS and a molecular weight of 222.11 g/mol. IUPAC name: (2S)-2-amino-2-(5-bromothiophen-2-yl)ethanol. InChIKey: BVJKDJWZRJAGIU-BYPYZUCNSA-N.
| Molecular formula | C6H8BrNOS |
|---|---|
| Molecular weight | 222.11 g/mol |
| IUPAC name | (2S)-2-amino-2-(5-bromothiophen-2-yl)ethanol |
| InChIKey | BVJKDJWZRJAGIU-BYPYZUCNSA-N |
| SMILES | C1=C(SC(=C1)Br)[C@H](CO)N |
Computed by PubChem (NCBI)