Products 1213696-91-3
CAS 1213696-91-3 appears in our catalog under these names: (S)-2-Amino-2-(2,5-difluorophenyl)ethanol, 95%, 95%, (2S)-2-AMINO-2-(2,5-DIFLUOROPHENYL)ETHAN-1-OL, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-amino-2-(2,5-difluorophenyl)ethanol (CAS 1213696-91-3) is a chemical compound with the molecular formula C8H9F2NO and a molecular weight of 173.16 g/mol. IUPAC name: (2S)-2-amino-2-(2,5-difluorophenyl)ethanol. InChIKey: MEFNBXBWLCZHCA-MRVPVSSYSA-N.
| Molecular formula | C8H9F2NO |
|---|---|
| Molecular weight | 173.16 g/mol |
| IUPAC name | (2S)-2-amino-2-(2,5-difluorophenyl)ethanol |
| InChIKey | MEFNBXBWLCZHCA-MRVPVSSYSA-N |
| SMILES | C1=CC(=C(C=C1F)[C@@H](CO)N)F |
Computed by PubChem (NCBI)