CAS 121373-20-4 is the registry number for Bis(2-(trimethylsilyl)ethyl) diisopropylphosphoramidite. Offered by: MedChemExpress. Available pack sizes: 5 g, 1 g.
N-[bis(2-trimethylsilylethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine (CAS 121373-20-4) is a chemical compound with the molecular formula C16H40NO2PSi2 and a molecular weight of 365.64 g/mol. IUPAC name: N-[bis(2-trimethylsilylethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine. InChIKey: UCVPTNNSVPPRRA-UHFFFAOYSA-N.
| Molecular formula | C16H40NO2PSi2 |
|---|---|
| Molecular weight | 365.64 g/mol |
| IUPAC name | N-[bis(2-trimethylsilylethoxy)phosphanyl]-N-propan-2-ylpropan-2-amine |
| InChIKey | UCVPTNNSVPPRRA-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)P(OCC[Si](C)(C)C)OCC[Si](C)(C)C |
Computed by PubChem (NCBI)