CAS 1213843-31-2 is the registry number for (R)-1-(4-(Difluoromethyl)-3-fluorophenyl)-2-methylpropan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-[4-(difluoromethyl)-3-fluorophenyl]-2-methylpropan-1-amine (CAS 1213843-31-2) is a chemical compound with the molecular formula C11H14F3N and a molecular weight of 217.23 g/mol. IUPAC name: (1R)-1-[4-(difluoromethyl)-3-fluorophenyl]-2-methylpropan-1-amine. InChIKey: BZXDVHYYCUHDHW-SNVBAGLBSA-N.
| Molecular formula | C11H14F3N |
|---|---|
| Molecular weight | 217.23 g/mol |
| IUPAC name | (1R)-1-[4-(difluoromethyl)-3-fluorophenyl]-2-methylpropan-1-amine |
| InChIKey | BZXDVHYYCUHDHW-SNVBAGLBSA-N |
| SMILES | CC(C)[C@H](C1=CC(=C(C=C1)C(F)F)F)N |
Computed by PubChem (NCBI)