Products 1213863-66-1
CAS 1213863-66-1 is the registry number for (R)-6-Chloro-4-methyl-2,3-dihydro-1H-inden-1-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-6-chloro-4-methyl-2,3-dihydro-1H-inden-1-amine (CAS 1213863-66-1) is a chemical compound with the molecular formula C10H12ClN and a molecular weight of 181.66 g/mol. IUPAC name: (1R)-6-chloro-4-methyl-2,3-dihydro-1H-inden-1-amine. InChIKey: APENXSRDYAVMSS-SNVBAGLBSA-N.
| Molecular formula | C10H12ClN |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | (1R)-6-chloro-4-methyl-2,3-dihydro-1H-inden-1-amine |
| InChIKey | APENXSRDYAVMSS-SNVBAGLBSA-N |
| SMILES | CC1=CC(=CC2=C1CC[C@H]2N)Cl |
Computed by PubChem (NCBI)