Products 1213977-49-1
CAS 1213977-49-1 is the registry number for (R)-6-bromo-2,3-dihydrobenzofuran-3-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
(3R)-6-bromo-2,3-dihydro-1-benzofuran-3-amine (CAS 1213977-49-1) is a chemical compound with the molecular formula C8H8BrNO and a molecular weight of 214.06 g/mol. IUPAC name: (3R)-6-bromo-2,3-dihydro-1-benzofuran-3-amine. InChIKey: VXHJNJHULJJTSD-ZETCQYMHSA-N.
| Molecular formula | C8H8BrNO |
|---|---|
| Molecular weight | 214.06 g/mol |
| IUPAC name | (3R)-6-bromo-2,3-dihydro-1-benzofuran-3-amine |
| InChIKey | VXHJNJHULJJTSD-ZETCQYMHSA-N |
| SMILES | C1[C@@H](C2=C(O1)C=C(C=C2)Br)N |
Computed by PubChem (NCBI)