CAS 1214-16-0 appears in our catalog under these names: 3,6–Dibromo–9–vinyl–9H–carbazole, 3,6-Dibromo-9-vinyl-9H-carbazole, >98.0%(GC), 3,6-Dibromo-9-vinyl-9H-carbazole 98%, 3,6-Dibromo-9-ethenyl-9H-carbazole, 98%, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg.
3,6-dibromo-9-ethenylcarbazole (CAS 1214-16-0) is a chemical compound with the molecular formula C14H9Br2N and a molecular weight of 351.04 g/mol. IUPAC name: 3,6-dibromo-9-ethenylcarbazole. InChIKey: ORMIJZCMQBMNFA-UHFFFAOYSA-N.
| Molecular formula | C14H9Br2N |
|---|---|
| Molecular weight | 351.04 g/mol |
| IUPAC name | 3,6-dibromo-9-ethenylcarbazole |
| InChIKey | ORMIJZCMQBMNFA-UHFFFAOYSA-N |
| SMILES | C=CN1C2=C(C=C(C=C2)Br)C3=C1C=CC(=C3)Br |
Computed by PubChem (NCBI)