CAS 1214158-74-3 appears in our catalog under these names: 2-(2,6-Dimethylmorpholin-4-yl)propanoic acid hydrochloride, 95%, 2-(2,6-Dimethylmorpholino)propanoic acid hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propanoic acid (CAS 1214158-74-3) is a chemical compound with the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. IUPAC name: 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propanoic acid. InChIKey: MXAGXWIBRZPNRW-DHBOJHSNSA-N.
| Molecular formula | C9H17NO3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propanoic acid |
| InChIKey | MXAGXWIBRZPNRW-DHBOJHSNSA-N |
| SMILES | C[C@@H]1CN(C[C@@H](O1)C)C(C)C(=O)O |
Computed by PubChem (NCBI)