CAS 1214160-37-8 is the registry number for 4-Methyl-2-[(4-methylphenyl)sulfonylamino]-n-(1-phenylethyl)pentanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
4-methyl-2-[(4-methylphenyl)sulfonylamino]-N-(1-phenylethyl)pentanamide (CAS 1214160-37-8) is a chemical compound with the molecular formula C21H28N2O3S and a molecular weight of 388.5 g/mol. IUPAC name: 4-methyl-2-[(4-methylphenyl)sulfonylamino]-N-(1-phenylethyl)pentanamide. InChIKey: OSRXWSQCLJVRTP-UHFFFAOYSA-N.
| Molecular formula | C21H28N2O3S |
|---|---|
| Molecular weight | 388.5 g/mol |
| IUPAC name | 4-methyl-2-[(4-methylphenyl)sulfonylamino]-N-(1-phenylethyl)pentanamide |
| InChIKey | OSRXWSQCLJVRTP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC(CC(C)C)C(=O)NC(C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)