Products 1214323-11-1
CAS 1214323-11-1 appears in our catalog under these names: 3–Fluoro–2–nitrobenzyl Alcohol, (3-Fluoro-2-nitrophenyl)methanol, 98%, 98%, 3-Fluoro-2-nitrobenzyl Alcohol, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
(3-fluoro-2-nitrophenyl)methanol (CAS 1214323-11-1) is a chemical compound with the molecular formula C7H6FNO3 and a molecular weight of 171.13 g/mol. IUPAC name: (3-fluoro-2-nitrophenyl)methanol. InChIKey: MMKNOYTVACESCK-UHFFFAOYSA-N.
| Molecular formula | C7H6FNO3 |
|---|---|
| Molecular weight | 171.13 g/mol |
| IUPAC name | (3-fluoro-2-nitrophenyl)methanol |
| InChIKey | MMKNOYTVACESCK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)[N+](=O)[O-])CO |
Computed by PubChem (NCBI)