CAS 1214327-17-9 appears in our catalog under these names: 6-(3-Fluorophenyl)pyridin-3-amine, 95%, 6-(3-Fluorophenyl)pyridin-3-amine, 95+%, 6-(3-Fluorophenyl)pyridin-3-amine 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
6-(3-fluorophenyl)pyridin-3-amine (CAS 1214327-17-9) is a chemical compound with the molecular formula C11H9FN2 and a molecular weight of 188.20 g/mol. IUPAC name: 6-(3-fluorophenyl)pyridin-3-amine. InChIKey: IMIGZVVRMOBRNL-UHFFFAOYSA-N.
| Molecular formula | C11H9FN2 |
|---|---|
| Molecular weight | 188.20 g/mol |
| IUPAC name | 6-(3-fluorophenyl)pyridin-3-amine |
| InChIKey | IMIGZVVRMOBRNL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=NC=C(C=C2)N |
Computed by PubChem (NCBI)