Products 1214331-70-0
CAS 1214331-70-0 is the registry number for 3-Chloro-5-(trifluoromethyl)-1,1'-biphenyl, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-chloro-3-phenyl-5-(trifluoromethyl)benzene (CAS 1214331-70-0) is a chemical compound with the molecular formula C13H8ClF3 and a molecular weight of 256.65 g/mol. IUPAC name: 1-chloro-3-phenyl-5-(trifluoromethyl)benzene. InChIKey: FCGUNKKTAKPJRX-UHFFFAOYSA-N.
| Molecular formula | C13H8ClF3 |
|---|---|
| Molecular weight | 256.65 g/mol |
| IUPAC name | 1-chloro-3-phenyl-5-(trifluoromethyl)benzene |
| InChIKey | FCGUNKKTAKPJRX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)