Products 1214332-89-4
CAS 1214332-89-4 is the registry number for 3-Bromo-6-(difluoromethoxy)-2-(trifluoromethyl)pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-6-(difluoromethoxy)-2-(trifluoromethyl)pyridine (CAS 1214332-89-4) is a chemical compound with the molecular formula C7H3BrF5NO and a molecular weight of 292.00 g/mol. IUPAC name: 3-bromo-6-(difluoromethoxy)-2-(trifluoromethyl)pyridine. InChIKey: PUEGFLPSEZHXNI-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF5NO |
|---|---|
| Molecular weight | 292.00 g/mol |
| IUPAC name | 3-bromo-6-(difluoromethoxy)-2-(trifluoromethyl)pyridine |
| InChIKey | PUEGFLPSEZHXNI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1Br)C(F)(F)F)OC(F)F |
Computed by PubChem (NCBI)