CAS 1214352-10-9 is the registry number for 5-Nitro-2-(trifluoromethyl)benzaldehyde, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
5-nitro-2-(trifluoromethyl)benzaldehyde (CAS 1214352-10-9) is a chemical compound with the molecular formula C8H4F3NO3 and a molecular weight of 219.12 g/mol. IUPAC name: 5-nitro-2-(trifluoromethyl)benzaldehyde. InChIKey: BSLICBYFAMBGOU-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO3 |
|---|---|
| Molecular weight | 219.12 g/mol |
| IUPAC name | 5-nitro-2-(trifluoromethyl)benzaldehyde |
| InChIKey | BSLICBYFAMBGOU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C=O)C(F)(F)F |
Computed by PubChem (NCBI)