Products 1214356-07-6
CAS 1214356-07-6 is the registry number for 2-Fluoro-4-(3-fluorophenyl)benzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-fluoro-4-(3-fluorophenyl)benzonitrile (CAS 1214356-07-6) is a chemical compound with the molecular formula C13H7F2N and a molecular weight of 215.20 g/mol. IUPAC name: 2-fluoro-4-(3-fluorophenyl)benzonitrile. InChIKey: KYACUYUBQSBPPB-UHFFFAOYSA-N.
| Molecular formula | C13H7F2N |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 2-fluoro-4-(3-fluorophenyl)benzonitrile |
| InChIKey | KYACUYUBQSBPPB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=CC(=C(C=C2)C#N)F |
Computed by PubChem (NCBI)