CAS 121451-05-6 is the registry number for 3,5-Dichloro-2-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)benzenamine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
3,5-dichloro-2-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)aniline (CAS 121451-05-6) is a chemical compound with the molecular formula C9H4Cl2F7NO and a molecular weight of 346.03 g/mol. IUPAC name: 3,5-dichloro-2-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)aniline. InChIKey: IESKMXZVWJJXPA-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2F7NO |
|---|---|
| Molecular weight | 346.03 g/mol |
| IUPAC name | 3,5-dichloro-2-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)aniline |
| InChIKey | IESKMXZVWJJXPA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Cl)OC(C(C(F)(F)F)F)(F)F)Cl)F)N |
Computed by PubChem (NCBI)