CAS 1214561-09-7 appears in our catalog under these names: HPK1-IN-8, 98%, HPK1–IN–8, HPK1-IN-8 98%, HPK1-IN-8, 98%, 98%, HPK1-IN-8, 98.56%. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 1 mg, 5 mg, 10 mg.
2-(3,7-dimethyl-5-oxo-1H-[1,2,4]triazolo[4,3-a]pyrimidin-6-yl)-N-[5-[(2-fluorophenyl)methyl]-1,3-thiazol-2-yl]acetamide (CAS 1214561-09-7) is a chemical compound with the molecular formula C19H17FN6O2S and a molecular weight of 412.4 g/mol. IUPAC name: 2-(3,7-dimethyl-5-oxo-1H-[1,2,4]triazolo[4,3-a]pyrimidin-6-yl)-N-[5-[(2-fluorophenyl)methyl]-1,3-thiazol-2-yl]acetamide. InChIKey: DKCQZXASVNYNLW-UHFFFAOYSA-N.
| Molecular formula | C19H17FN6O2S |
|---|---|
| Molecular weight | 412.4 g/mol |
| IUPAC name | 2-(3,7-dimethyl-5-oxo-1H-[1,2,4]triazolo[4,3-a]pyrimidin-6-yl)-N-[5-[(2-fluorophenyl)methyl]-1,3-thiazol-2-yl]acetamide |
| InChIKey | DKCQZXASVNYNLW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N2C(=NNC2=N1)C)CC(=O)NC3=NC=C(S3)CC4=CC=CC=C4F |
Computed by PubChem (NCBI)