CAS 1214670-87-7 is the registry number for Sodium 6,6-dibromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6,6-dibromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (CAS 1214670-87-7) is a chemical compound with the molecular formula C8H8Br2NO3S- and a molecular weight of 358.03 g/mol. IUPAC name: 6,6-dibromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate. InChIKey: YLGIIVBDSLVWDR-UHFFFAOYSA-M.
| Molecular formula | C8H8Br2NO3S- |
|---|---|
| Molecular weight | 358.03 g/mol |
| IUPAC name | 6,6-dibromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| InChIKey | YLGIIVBDSLVWDR-UHFFFAOYSA-M |
| SMILES | CC1(C(N2C(S1)C(C2=O)(Br)Br)C(=O)[O-])C |
Computed by PubChem (NCBI)