CAS 1214718-98-5 appears in our catalog under these names: Bis((±)-2-ethylhexyl) Hexane-d8-dioate, 98 atom % D, min 98% Chemical Purity, Bis(2–ethylhexyl) adipate–d8, Bis(2-ethylhexyl)adipate-d8, >95% (HPLC), Bis(2-ethylhexyl) adipate-d8, 99.97%, D8-Bis(2-ethylhexyl) adipate, Concentration: 100 µg/ml Solvent: Cyclohexane. Offered by: CDN, GLPBio, TRC, MedChemExpress, HPC Standards. Available pack sizes: 0,25g, 0,1g, 5mg, 10mg, 1mg, 5 mg, 1 mg, 10 mg.
Bis(2-ethylhexyl) 2,2,3,3,4,4,5,5-octadeuteriohexanedioate (CAS 1214718-98-5) is a chemical compound with the molecular formula C22H42O4 and a molecular weight of 378.6 g/mol. IUPAC name: bis(2-ethylhexyl) 2,2,3,3,4,4,5,5-octadeuteriohexanedioate. InChIKey: SAOKZLXYCUGLFA-QSIDXAOLSA-N.
| Molecular formula | C22H42O4 |
|---|---|
| Molecular weight | 378.6 g/mol |
| IUPAC name | bis(2-ethylhexyl) 2,2,3,3,4,4,5,5-octadeuteriohexanedioate |
| InChIKey | SAOKZLXYCUGLFA-QSIDXAOLSA-N |
| SMILES | [2H]C([2H])(C(=O)OCC(CC)CCCC)C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)OCC(CC)CCCC |
Computed by PubChem (NCBI)