CAS 1214723-26-8 appears in our catalog under these names: 3-(1-Phenyl-1h-benzo[d]imidazol-2-yl)phenylboronic acid, 95%, 3-(1-phenyl-1H-benzo(d)imidazol-2-yl)phenylboronic acid3-(1-phenyl-1H-benzo(d)imidazol-2-yl)phenylboronic acid, >98%, (3–(1–Phenyl–1H–benzo(d)imidazol–2–yl)phenyl)boronic acid. Offered by: Combi-blocks, Lumtec, GLPBio. Available pack sizes: 100mg, 1g, 250mg, On request.
[3-(1-phenylbenzimidazol-2-yl)phenyl]boronic acid (CAS 1214723-26-8) is a chemical compound with the molecular formula C19H15BN2O2 and a molecular weight of 314.1 g/mol. IUPAC name: [3-(1-phenylbenzimidazol-2-yl)phenyl]boronic acid. InChIKey: YALVJUMJQAACQL-UHFFFAOYSA-N.
| Molecular formula | C19H15BN2O2 |
|---|---|
| Molecular weight | 314.1 g/mol |
| IUPAC name | [3-(1-phenylbenzimidazol-2-yl)phenyl]boronic acid |
| InChIKey | YALVJUMJQAACQL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=NC3=CC=CC=C3N2C4=CC=CC=C4)(O)O |
Computed by PubChem (NCBI)