CAS 121476-13-9 is the registry number for 4-(4-Amino-3-methylphenyl)-2-methylaniline 2-methylphenol. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.
4-(4-amino-3-methylphenyl)-2-methylaniline;2-methylphenol (CAS 121476-13-9) is a chemical compound with the molecular formula C21H24N2O and a molecular weight of 320.4 g/mol. IUPAC name: 4-(4-amino-3-methylphenyl)-2-methylaniline;2-methylphenol. InChIKey: LOAWCZVVIQTVPY-UHFFFAOYSA-N.
| Molecular formula | C21H24N2O |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 4-(4-amino-3-methylphenyl)-2-methylaniline;2-methylphenol |
| InChIKey | LOAWCZVVIQTVPY-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1O.CC1=C(C=CC(=C1)C2=CC(=C(C=C2)N)C)N |
Computed by PubChem (NCBI)