CAS 1214817-36-3 appears in our catalog under these names: 2-Amino-4-methanesulfonylbutanamide hydrobromide, 95%, 2-Amino-4-methanesulfonylbutanamide hydrobromide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 25mg, 100mg, 250mg, 500mg.
2-amino-4-methylsulfonylbutanamide;hydrobromide (CAS 1214817-36-3) is a chemical compound with the molecular formula C5H13BrN2O3S and a molecular weight of 261.14 g/mol. IUPAC name: 2-amino-4-methylsulfonylbutanamide;hydrobromide. InChIKey: RHGBRSPOBBLIJL-UHFFFAOYSA-N.
| Molecular formula | C5H13BrN2O3S |
|---|---|
| Molecular weight | 261.14 g/mol |
| IUPAC name | 2-amino-4-methylsulfonylbutanamide;hydrobromide |
| InChIKey | RHGBRSPOBBLIJL-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CCC(C(=O)N)N.Br |
Computed by PubChem (NCBI)