CAS 1214842-25-7 appears in our catalog under these names: 2-(1-(4-Fluorophenyl)-2,5-dioxoimidazolidin-4-yl)acetic acid, 95%, 2-(1-(4-Fluorophenyl)-2,5-dioxoimidazolidin-4-yl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-[1-(4-fluorophenyl)-2,5-dioxoimidazolidin-4-yl]acetic acid (CAS 1214842-25-7) is a chemical compound with the molecular formula C11H9FN2O4 and a molecular weight of 252.20 g/mol. IUPAC name: 2-[1-(4-fluorophenyl)-2,5-dioxoimidazolidin-4-yl]acetic acid. InChIKey: GTGJKPVEGYMXKS-UHFFFAOYSA-N.
| Molecular formula | C11H9FN2O4 |
|---|---|
| Molecular weight | 252.20 g/mol |
| IUPAC name | 2-[1-(4-fluorophenyl)-2,5-dioxoimidazolidin-4-yl]acetic acid |
| InChIKey | GTGJKPVEGYMXKS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C(NC2=O)CC(=O)O)F |
Computed by PubChem (NCBI)