Products 121487-66-9

CAS 121487-66-9 is the registry number for Ethyl octyl hexane-1,6-diyldicarbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg.

Structural formula: {0} (CAS {1})

Octyl N-[6-(ethoxycarbonylamino)hexyl]carbamate (CAS 121487-66-9) is a chemical compound with the molecular formula C18H36N2O4 and a molecular weight of 344.5 g/mol. IUPAC name: octyl N-[6-(ethoxycarbonylamino)hexyl]carbamate. InChIKey: TXBICVGFHZJUPH-UHFFFAOYSA-N.

Identity
Molecular formulaC18H36N2O4
Molecular weight344.5 g/mol
IUPAC nameoctyl N-[6-(ethoxycarbonylamino)hexyl]carbamate
InChIKeyTXBICVGFHZJUPH-UHFFFAOYSA-N
SMILESCCCCCCCCOC(=O)NCCCCCCNC(=O)OCC

Computed by PubChem (NCBI)