CAS 1215-42-5 appears in our catalog under these names: (4-Bromophenyl)-(4-bromophenyl)imino-oxidoazanium, 95%, 4,4'-Dibromoazoxybenzene, 1,2-Bis(4-bromophenyl)diazene 1-oxide, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 100mg.
(4-bromophenyl)-(4-bromophenyl)imino-oxidoazanium (CAS 1215-42-5) is a chemical compound with the molecular formula C12H8Br2N2O and a molecular weight of 356.01 g/mol. IUPAC name: (4-bromophenyl)-(4-bromophenyl)imino-oxidoazanium. InChIKey: IPXUSIUMPSGLFK-UHFFFAOYSA-N.
| Molecular formula | C12H8Br2N2O |
|---|---|
| Molecular weight | 356.01 g/mol |
| IUPAC name | (4-bromophenyl)-(4-bromophenyl)imino-oxidoazanium |
| InChIKey | IPXUSIUMPSGLFK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=[N+](C2=CC=C(C=C2)Br)[O-])Br |
Computed by PubChem (NCBI)