CAS 1215071-59-2 is the registry number for 6–(Methyl–D3)–pyrazine–2–carboxylic acid. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
6-(trideuteriomethyl)pyrazine-2-carboxylic acid (CAS 1215071-59-2) is a chemical compound with the molecular formula C6H6N2O2 and a molecular weight of 141.14 g/mol. IUPAC name: 6-(trideuteriomethyl)pyrazine-2-carboxylic acid. InChIKey: YDSUJIRXXROKQG-FIBGUPNXSA-N.
| Molecular formula | C6H6N2O2 |
|---|---|
| Molecular weight | 141.14 g/mol |
| IUPAC name | 6-(trideuteriomethyl)pyrazine-2-carboxylic acid |
| InChIKey | YDSUJIRXXROKQG-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CN=CC(=N1)C(=O)O |
Computed by PubChem (NCBI)