Products 1215074-33-1
CAS 1215074-33-1 is the registry number for 2–Chloro–4–amino–6–(iso–propyl–d7)–pyrimidine. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
2-chloro-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyrimidin-4-amine (CAS 1215074-33-1) is a chemical compound with the molecular formula C7H10ClN3 and a molecular weight of 178.67 g/mol. IUPAC name: 2-chloro-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyrimidin-4-amine. InChIKey: XBOHJBMIGNEQEH-UAVYNJCWSA-N.
| Molecular formula | C7H10ClN3 |
|---|---|
| Molecular weight | 178.67 g/mol |
| IUPAC name | 2-chloro-6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)pyrimidin-4-amine |
| InChIKey | XBOHJBMIGNEQEH-UAVYNJCWSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C1=CC(=NC(=N1)Cl)N)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)