CAS 121512-58-1 appears in our catalog under these names: 2-(3-Chloroquinoxalin-2-yl)-2-(phenylsulfonyl)acetonitrile, 98+%, 2-(Benzenesulfonyl)-2-(3-chloroquinoxalin-2-yl)acetonitrile. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 250mg, 2,5g.
2-(benzenesulfonyl)-2-(3-chloroquinoxalin-2-yl)acetonitrile (CAS 121512-58-1) is a chemical compound with the molecular formula C16H10ClN3O2S and a molecular weight of 343.8 g/mol. IUPAC name: 2-(benzenesulfonyl)-2-(3-chloroquinoxalin-2-yl)acetonitrile. InChIKey: XDUDZMHWULSAEP-UHFFFAOYSA-N.
| Molecular formula | C16H10ClN3O2S |
|---|---|
| Molecular weight | 343.8 g/mol |
| IUPAC name | 2-(benzenesulfonyl)-2-(3-chloroquinoxalin-2-yl)acetonitrile |
| InChIKey | XDUDZMHWULSAEP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)C(C#N)C2=NC3=CC=CC=C3N=C2Cl |
Computed by PubChem (NCBI)