Products 1215205-82-5

CAS 1215205-82-5 is the registry number for 4,4'-Difluorobiphenyl-2,2'-dicarboxylic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100g, 25g, 5g.

Structural formula: {0} (CAS {1})

2-(2-carboxy-4-fluorophenyl)-5-fluorobenzoic acid (CAS 1215205-82-5) is a chemical compound with the molecular formula C14H8F2O4 and a molecular weight of 278.21 g/mol. IUPAC name: 2-(2-carboxy-4-fluorophenyl)-5-fluorobenzoic acid. InChIKey: JSSMUAXMMGJSIY-UHFFFAOYSA-N.

Identity
Molecular formulaC14H8F2O4
Molecular weight278.21 g/mol
IUPAC name2-(2-carboxy-4-fluorophenyl)-5-fluorobenzoic acid
InChIKeyJSSMUAXMMGJSIY-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)C(=O)O)C2=C(C=C(C=C2)F)C(=O)O

Computed by PubChem (NCBI)