CAS 1215205-82-5 is the registry number for 4,4'-Difluorobiphenyl-2,2'-dicarboxylic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100g, 25g, 5g.
2-(2-carboxy-4-fluorophenyl)-5-fluorobenzoic acid (CAS 1215205-82-5) is a chemical compound with the molecular formula C14H8F2O4 and a molecular weight of 278.21 g/mol. IUPAC name: 2-(2-carboxy-4-fluorophenyl)-5-fluorobenzoic acid. InChIKey: JSSMUAXMMGJSIY-UHFFFAOYSA-N.
| Molecular formula | C14H8F2O4 |
|---|---|
| Molecular weight | 278.21 g/mol |
| IUPAC name | 2-(2-carboxy-4-fluorophenyl)-5-fluorobenzoic acid |
| InChIKey | JSSMUAXMMGJSIY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)O)C2=C(C=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)