CAS 1215205-85-8 is the registry number for 5-Bromo-2-mercapto-6-methoxybenzothiazole, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
5-bromo-6-methoxy-3H-1,3-benzothiazole-2-thione (CAS 1215205-85-8) is a chemical compound with the molecular formula C8H6BrNOS2 and a molecular weight of 276.2 g/mol. IUPAC name: 5-bromo-6-methoxy-3H-1,3-benzothiazole-2-thione. InChIKey: PHAGEHCGWCLLAJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNOS2 |
|---|---|
| Molecular weight | 276.2 g/mol |
| IUPAC name | 5-bromo-6-methoxy-3H-1,3-benzothiazole-2-thione |
| InChIKey | PHAGEHCGWCLLAJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)SC(=S)N2)Br |
Computed by PubChem (NCBI)