CAS 1215205-89-2 is the registry number for 5-Bromo-2-(N-BOC-N-cyclopropylaminopyrimidine, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Tert-butyl N-(5-bromopyrimidin-2-yl)-N-cyclopropylcarbamate (CAS 1215205-89-2) is a chemical compound with the molecular formula C12H16BrN3O2 and a molecular weight of 314.18 g/mol. IUPAC name: tert-butyl N-(5-bromopyrimidin-2-yl)-N-cyclopropylcarbamate. InChIKey: AEFKUGYFFRKJFT-UHFFFAOYSA-N.
| Molecular formula | C12H16BrN3O2 |
|---|---|
| Molecular weight | 314.18 g/mol |
| IUPAC name | tert-butyl N-(5-bromopyrimidin-2-yl)-N-cyclopropylcarbamate |
| InChIKey | AEFKUGYFFRKJFT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1CC1)C2=NC=C(C=N2)Br |
Computed by PubChem (NCBI)