CAS 1215206-47-5 is the registry number for 4-Bromo-2-mercapto-6-(trifluoromethoxy)benzothiazole, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
4-bromo-6-(trifluoromethoxy)-3H-1,3-benzothiazole-2-thione (CAS 1215206-47-5) is a chemical compound with the molecular formula C8H3BrF3NOS2 and a molecular weight of 330.1 g/mol. IUPAC name: 4-bromo-6-(trifluoromethoxy)-3H-1,3-benzothiazole-2-thione. InChIKey: JQMOBYLYYWNJBN-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF3NOS2 |
|---|---|
| Molecular weight | 330.1 g/mol |
| IUPAC name | 4-bromo-6-(trifluoromethoxy)-3H-1,3-benzothiazole-2-thione |
| InChIKey | JQMOBYLYYWNJBN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1SC(=S)N2)Br)OC(F)(F)F |
Computed by PubChem (NCBI)