CAS 1215370-80-1 is the registry number for 5–Aminopentanoic Acid Methyl Ester Hydrochloride–d4. Offered by: GLPBio. Available pack sizes: 5mg.
Methyl 5-amino-3,3,4,4-tetradeuteriopentanoate;hydrochloride (CAS 1215370-80-1) is a chemical compound with the molecular formula C6H14ClNO2 and a molecular weight of 171.66 g/mol. IUPAC name: methyl 5-amino-3,3,4,4-tetradeuteriopentanoate;hydrochloride. InChIKey: FAKIZCQRTPAOSH-DAHDXRBSSA-N.
| Molecular formula | C6H14ClNO2 |
|---|---|
| Molecular weight | 171.66 g/mol |
| IUPAC name | methyl 5-amino-3,3,4,4-tetradeuteriopentanoate;hydrochloride |
| InChIKey | FAKIZCQRTPAOSH-DAHDXRBSSA-N |
| SMILES | [2H]C([2H])(CC(=O)OC)C([2H])([2H])CN.Cl |
Computed by PubChem (NCBI)