Products 1215372-45-4
CAS 1215372-45-4 is the registry number for 3-(4,5-Diphenyl-1h-imidazol-1-yl)propanoic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
3-(4,5-diphenylimidazol-1-yl)propanoic acid;hydrochloride (CAS 1215372-45-4) is a chemical compound with the molecular formula C18H17ClN2O2 and a molecular weight of 328.8 g/mol. IUPAC name: 3-(4,5-diphenylimidazol-1-yl)propanoic acid;hydrochloride. InChIKey: OMYMZGGPLKXPDS-UHFFFAOYSA-N.
| Molecular formula | C18H17ClN2O2 |
|---|---|
| Molecular weight | 328.8 g/mol |
| IUPAC name | 3-(4,5-diphenylimidazol-1-yl)propanoic acid;hydrochloride |
| InChIKey | OMYMZGGPLKXPDS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N(C=N2)CCC(=O)O)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)