CAS 1215380-71-4 is the registry number for Cadusafos-d5. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 5mg, 10mg, 25mg, 50mg.
2-[butan-2-ylsulfanyl(1,1,2,2,2-pentadeuterioethoxy)phosphoryl]sulfanylbutane (CAS 1215380-71-4) is a chemical compound with the molecular formula C10H23O2PS2 and a molecular weight of 275.4 g/mol. IUPAC name: 2-[butan-2-ylsulfanyl(1,1,2,2,2-pentadeuterioethoxy)phosphoryl]sulfanylbutane. InChIKey: KXRPCFINVWWFHQ-GRZQFIOJSA-N.
| Molecular formula | C10H23O2PS2 |
|---|---|
| Molecular weight | 275.4 g/mol |
| IUPAC name | 2-[butan-2-ylsulfanyl(1,1,2,2,2-pentadeuterioethoxy)phosphoryl]sulfanylbutane |
| InChIKey | KXRPCFINVWWFHQ-GRZQFIOJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OP(=O)(SC(C)CC)SC(C)CC |
Computed by PubChem (NCBI)