CAS 1215385-33-3 appears in our catalog under these names: (4R)-4-Methoxy-1-methyl-D-proline, HCl, 95%, (2R,4R)-4-Methoxy-1-methylpyrrolidine-2-carboxylic acid hydrochloride, 97%, (2R,4R)–4–methoxy–1–methylpyrrolidine–2–carboxylic acid hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g.
(2R,4R)-4-methoxy-1-methylpyrrolidine-2-carboxylic acid;hydrochloride (CAS 1215385-33-3) is a chemical compound with the molecular formula C7H14ClNO3 and a molecular weight of 195.64 g/mol. IUPAC name: (2R,4R)-4-methoxy-1-methylpyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: HBOAHGNESDTECM-KGZKBUQUSA-N.
| Molecular formula | C7H14ClNO3 |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | (2R,4R)-4-methoxy-1-methylpyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | HBOAHGNESDTECM-KGZKBUQUSA-N |
| SMILES | CN1C[C@@H](C[C@@H]1C(=O)O)OC.Cl |
Computed by PubChem (NCBI)